C25H24N4O3S — CID 91617398
N-hydroxy-5-[2-[[3-(2-pyridin-2-ylethenyl)-1H-indazol-6-yl]sulfanyl]phenoxy]pentanamide (PubChem CID 91617398) has the molecular formula C25H24N4O3S and a molecular weight of 460.56 g/mol. Its IUPAC name is N-hydroxy-5-[2-[[3-(2-pyridin-2-ylethenyl)-1H-indazol-6-yl]sulfanyl]phenoxy]pentanamide.
| Compound Name | N-hydroxy-5-[2-[[3-(2-pyridin-2-ylethenyl)-1H-indazol-6-yl]sulfanyl]phenoxy]pentanamide |
|---|---|
| PubChem CID | 91617398 |
| Molecular Formula | C25H24N4O3S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | N-hydroxy-5-[2-[[3-(2-pyridin-2-ylethenyl)-1H-indazol-6-yl]sulfanyl]phenoxy]pentanamide |
| SMILES | O=C(CCCCOc1ccccc1Sc1ccc2c(C=Cc3ccccn3)n[nH]c2c1)NO |
| InChI | InChI=1S/C25H24N4O3S/c30-25(29-31)10-4-6-16-32-23-8-1-2-9-24(23)33-19-12-13-20-21(27-28-22(20)17-19)14-11-18-7-3-5-15-26-18/h1-3,5,7-9,11-15,17,31H,4,6,10,16H2,(H,27,28)(H,29,30) |
| InChIKey | JXBAKDKHRFOCGE-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|