About [3,5-di(propanoyloxy)-3-(2-propylheptyl)cyclohexyl] propanoate
[3,5-di(propanoyloxy)-3-(2-propylheptyl)cyclohexyl] propanoate (PubChem CID 175138708) has the molecular formula C25H44O6
and a molecular weight of 440.62 g/mol. Its IUPAC name is [3,5-di(propanoyloxy)-3-(2-propylheptyl)cyclohexyl] propanoate.
Molecular Properties
| Compound Name | [3,5-di(propanoyloxy)-3-(2-propylheptyl)cyclohexyl] propanoate |
| PubChem CID | 175138708 |
| Molecular Formula | C25H44O6 |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 440.31 |
| IUPAC Name | [3,5-di(propanoyloxy)-3-(2-propylheptyl)cyclohexyl] propanoate |
| SMILES | CCCCCC(CCC)CC1(OC(=O)CC)CC(OC(=O)CC)CC(OC(=O)CC)C1 |
| InChI | InChI=1S/C25H44O6/c1-6-11-12-14-19(13-7-2)16-25(31-24(28)10-5)17-20(29-22(26)8-3)15-21(18-25)30-23(27)9-4/h19-21H,6-18H2,1-5H3 |
| InChIKey | OOSZWJHSGPSBAI-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [3,5-di(propanoyloxy)-3-(2-propylheptyl)cyclohexyl] propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,5-di(propanoyloxy)-3-(2-propylheptyl)cyclohexyl] propanoate?
The IUPAC name of [3,5-di(propanoyloxy)-3-(2-propylheptyl)cyclohexyl] propanoate (CID 175138708) is [3,5-di(propanoyloxy)-3-(2-propylheptyl)cyclohexyl] propanoate.
What is the SMILES notation for [3,5-di(propanoyloxy)-3-(2-propylheptyl)cyclohexyl] propanoate?
The canonical SMILES for [3,5-di(propanoyloxy)-3-(2-propylheptyl)cyclohexyl] propanoate is CCCCCC(CCC)CC1(OC(=O)CC)CC(OC(=O)CC)CC(OC(=O)CC)C1.
What is the InChIKey of [3,5-di(propanoyloxy)-3-(2-propylheptyl)cyclohexyl] propanoate?
The InChIKey is OOSZWJHSGPSBAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H44O6/c1-6-11-12-14-19(13-7-2)16-25(31-24(28)10-5)17-20(29-22(26)8-3)15-21(18-25)30-23(27)9-4/h19-21H,6-18H2,1-5H3.
What are the key properties of [3,5-di(propanoyloxy)-3-(2-propylheptyl)cyclohexyl] propanoate?
[3,5-di(propanoyloxy)-3-(2-propylheptyl)cyclohexyl] propanoate has a molecular weight of 440.62 g/mol, XLogP of 5.89, 14 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3,5-di(propanoyloxy)-3-(2-propylheptyl)cyclohexyl] propanoate is sourced from PubChem (CID 175138708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).