C23H40O6 — CID 175357650
[4-(2-ethylhexyl)-3,4-di(propanoyloxy)cyclohexyl] propanoate (PubChem CID 175357650) has the molecular formula C23H40O6 and a molecular weight of 412.57 g/mol. Its IUPAC name is [4-(2-ethylhexyl)-3,4-di(propanoyloxy)cyclohexyl] propanoate.
| Compound Name | [4-(2-ethylhexyl)-3,4-di(propanoyloxy)cyclohexyl] propanoate |
|---|---|
| PubChem CID | 175357650 |
| Molecular Formula | C23H40O6 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | [4-(2-ethylhexyl)-3,4-di(propanoyloxy)cyclohexyl] propanoate |
| SMILES | CCCCC(CC)CC1(OC(=O)CC)CCC(OC(=O)CC)CC1OC(=O)CC |
| InChI | InChI=1S/C23H40O6/c1-6-11-12-17(7-2)16-23(29-22(26)10-5)14-13-18(27-20(24)8-3)15-19(23)28-21(25)9-4/h17-19H,6-16H2,1-5H3 |
| InChIKey | CFDXEERQUWDMNZ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|