C14H23NO6 — CID 175139351
3-[5-[(2-methylpropan-2-yl)oxy]-3,5-dioxopentan-2-yl]oxypyrrolidine-1-carboxylic acid (PubChem CID 175139351) has the molecular formula C14H23NO6 and a molecular weight of 301.34 g/mol. Its IUPAC name is 3-[5-[(2-methylpropan-2-yl)oxy]-3,5-dioxopentan-2-yl]oxypyrrolidine-1-carboxylic acid.
| Compound Name | 3-[5-[(2-methylpropan-2-yl)oxy]-3,5-dioxopentan-2-yl]oxypyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 175139351 |
| Molecular Formula | C14H23NO6 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 3-[5-[(2-methylpropan-2-yl)oxy]-3,5-dioxopentan-2-yl]oxypyrrolidine-1-carboxylic acid |
| SMILES | CC(OC1CCN(C(=O)O)C1)C(=O)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H23NO6/c1-9(11(16)7-12(17)21-14(2,3)4)20-10-5-6-15(8-10)13(18)19/h9-10H,5-8H2,1-4H3,(H,18,19) |
| InChIKey | JFOULOIFHWRPDJ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|