C10H19NO5S — CID 87292136
(3R)-3-(2,2-dimethylpropylsulfonyloxy)pyrrolidine-1-carboxylic acid (PubChem CID 87292136) has the molecular formula C10H19NO5S and a molecular weight of 265.33 g/mol. Its IUPAC name is (3R)-3-(2,2-dimethylpropylsulfonyloxy)pyrrolidine-1-carboxylic acid.
| Compound Name | (3R)-3-(2,2-dimethylpropylsulfonyloxy)pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 87292136 |
| Molecular Formula | C10H19NO5S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | (3R)-3-(2,2-dimethylpropylsulfonyloxy)pyrrolidine-1-carboxylic acid |
| SMILES | CC(C)(C)CS(=O)(=O)O[C@@H]1CCN(C(=O)O)C1 |
| InChI | InChI=1S/C10H19NO5S/c1-10(2,3)7-17(14,15)16-8-4-5-11(6-8)9(12)13/h8H,4-7H2,1-3H3,(H,12,13)/t8-/m1/s1 |
| InChIKey | OQZBAEFHZJNVDQ-MRVPVSSYSA-N |
| XLogP | 1.13 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|