C10H20O3S — CID 174663479
cyclopentyl 2,2-dimethylpropane-1-sulfonate (PubChem CID 174663479) has the molecular formula C10H20O3S and a molecular weight of 220.33 g/mol. Its IUPAC name is cyclopentyl 2,2-dimethylpropane-1-sulfonate.
| Compound Name | cyclopentyl 2,2-dimethylpropane-1-sulfonate |
|---|---|
| PubChem CID | 174663479 |
| Molecular Formula | C10H20O3S |
| Molecular Weight | 220.33 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | cyclopentyl 2,2-dimethylpropane-1-sulfonate |
| SMILES | CC(C)(C)CS(=O)(=O)OC1CCCC1 |
| InChI | InChI=1S/C10H20O3S/c1-10(2,3)8-14(11,12)13-9-6-4-5-7-9/h9H,4-8H2,1-3H3 |
| InChIKey | BARWUPIYGYOSRQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|