C19H36O12S4 — CID 122600071
bis(cyclohexyloxysulfonylmethyl) pentane-1,5-disulfonate (PubChem CID 122600071) has the molecular formula C19H36O12S4 and a molecular weight of 584.75 g/mol. Its IUPAC name is bis(cyclohexyloxysulfonylmethyl) pentane-1,5-disulfonate.
| Compound Name | bis(cyclohexyloxysulfonylmethyl) pentane-1,5-disulfonate |
|---|---|
| PubChem CID | 122600071 |
| Molecular Formula | C19H36O12S4 |
| Molecular Weight | 584.75 g/mol |
| Exact Mass | 584.11 |
| IUPAC Name | bis(cyclohexyloxysulfonylmethyl) pentane-1,5-disulfonate |
| SMILES | O=S(=O)(CCCCCS(=O)(=O)OCS(=O)(=O)OC1CCCCC1)OCS(=O)(=O)OC1CCCCC1 |
| InChI | InChI=1S/C19H36O12S4/c20-32(21,28-16-34(24,25)30-18-10-4-1-5-11-18)14-8-3-9-15-33(22,23)29-17-35(26,27)31-19-12-6-2-7-13-19/h18-19H,1-17H2 |
| InChIKey | KNOYFYQUUOCHLQ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 173.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.75 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|