C9H20O11S4 — CID 122600098
5-O-(methoxysulfonylmethyl) 1-O-(methylsulfonylmethyl) pentane-1,5-disulfonate (PubChem CID 122600098) has the molecular formula C9H20O11S4 and a molecular weight of 432.52 g/mol. Its IUPAC name is 5-O-(methoxysulfonylmethyl) 1-O-(methylsulfonylmethyl) pentane-1,5-disulfonate.
| Compound Name | 5-O-(methoxysulfonylmethyl) 1-O-(methylsulfonylmethyl) pentane-1,5-disulfonate |
|---|---|
| PubChem CID | 122600098 |
| Molecular Formula | C9H20O11S4 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 431.99 |
| IUPAC Name | 5-O-(methoxysulfonylmethyl) 1-O-(methylsulfonylmethyl) pentane-1,5-disulfonate |
| SMILES | COS(=O)(=O)COS(=O)(=O)CCCCCS(=O)(=O)OCS(C)(=O)=O |
| InChI | InChI=1S/C9H20O11S4/c1-18-24(16,17)9-20-23(14,15)7-5-3-4-6-22(12,13)19-8-21(2,10)11/h3-9H2,1-2H3 |
| InChIKey | MMTKXZCXDPITBS-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 164.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|