C25H48Si — CID 175140524
1,2,3-triheptyl-1H-silole (PubChem CID 175140524) has the molecular formula C25H48Si and a molecular weight of 376.75 g/mol. Its IUPAC name is 1,2,3-triheptyl-1H-silole.
| Compound Name | 1,2,3-triheptyl-1H-silole |
|---|---|
| PubChem CID | 175140524 |
| Molecular Formula | C25H48Si |
| Molecular Weight | 376.75 g/mol |
| Exact Mass | 376.35 |
| IUPAC Name | 1,2,3-triheptyl-1H-silole |
| SMILES | CCCCCCCC1=C(CCCCCCC)[SiH](CCCCCCC)C=C1 |
| InChI | InChI=1S/C25H48Si/c1-4-7-10-13-16-19-24-21-23-26(22-18-15-12-9-6-3)25(24)20-17-14-11-8-5-2/h21,23,26H,4-20,22H2,1-3H3 |
| InChIKey | RRVMXEYWUWBFRP-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.75 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|