C13H21Cl — CID 90487594
2-hexyl-1,5-dimethylcyclopenta-1,3-diene chloride (PubChem CID 90487594) has the molecular formula C13H21Cl and a molecular weight of 212.76 g/mol. Its IUPAC name is 2-hexyl-1,5-dimethylcyclopenta-1,3-diene chloride.
| Compound Name | 2-hexyl-1,5-dimethylcyclopenta-1,3-diene chloride |
|---|---|
| PubChem CID | 90487594 |
| Molecular Formula | C13H21Cl |
| Molecular Weight | 212.76 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 2-hexyl-1,5-dimethylcyclopenta-1,3-diene chloride |
| SMILES | CCCCCCC1=C(C)[C+](C)C=C1.[Cl-] |
| InChI | InChI=1S/C13H21.ClH/c1-4-5-6-7-8-13-10-9-11(2)12(13)3;/h9-10H,4-8H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | PHXIDFVWJMBKTP-UHFFFAOYSA-M |
| XLogP | 1.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.76 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|