C11H24O3Si — CID 175140530
4-[dimethyl(oxan-2-yl)silyl]butane-1,1-diol (PubChem CID 175140530) has the molecular formula C11H24O3Si and a molecular weight of 232.40 g/mol. Its IUPAC name is 4-[dimethyl(oxan-2-yl)silyl]butane-1,1-diol.
| Compound Name | 4-[dimethyl(oxan-2-yl)silyl]butane-1,1-diol |
|---|---|
| PubChem CID | 175140530 |
| Molecular Formula | C11H24O3Si |
| Molecular Weight | 232.40 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | 4-[dimethyl(oxan-2-yl)silyl]butane-1,1-diol |
| SMILES | C[Si](C)(CCCC(O)O)C1CCCCO1 |
| InChI | InChI=1S/C11H24O3Si/c1-15(2,9-5-6-10(12)13)11-7-3-4-8-14-11/h10-13H,3-9H2,1-2H3 |
| InChIKey | UVZSAVJWCHSMHM-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.40 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|