C27H23FN4O4 — CID 175141866
[2-fluoro-4-[5-[5-(1-phenylethoxycarbonylamino)pyrazol-1-yl]-2-pyridinyl]phenyl] cyclopropanecarboxylate (PubChem CID 175141866) has the molecular formula C27H23FN4O4 and a molecular weight of 486.50 g/mol. Its IUPAC name is [2-fluoro-4-[5-[5-(1-phenylethoxycarbonylamino)pyrazol-1-yl]-2-pyridinyl]phenyl] cyclopropanecarboxylate.
| Compound Name | [2-fluoro-4-[5-[5-(1-phenylethoxycarbonylamino)pyrazol-1-yl]-2-pyridinyl]phenyl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 175141866 |
| Molecular Formula | C27H23FN4O4 |
| Molecular Weight | 486.50 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | [2-fluoro-4-[5-[5-(1-phenylethoxycarbonylamino)pyrazol-1-yl]-2-pyridinyl]phenyl] cyclopropanecarboxylate |
| SMILES | CC(OC(=O)Nc1ccnn1-c1ccc(-c2ccc(OC(=O)C3CC3)c(F)c2)nc1)c1ccccc1 |
| InChI | InChI=1S/C27H23FN4O4/c1-17(18-5-3-2-4-6-18)35-27(34)31-25-13-14-30-32(25)21-10-11-23(29-16-21)20-9-12-24(22(28)15-20)36-26(33)19-7-8-19/h2-6,9-17,19H,7-8H2,1H3,(H,31,34) |
| InChIKey | PCIJRUCSBNVVFV-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.50 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|