About 2-(2-methanidylphenyl)ethanamine;palladium
2-(2-methanidylphenyl)ethanamine;palladium (PubChem CID 175142647) has the molecular formula C9H12NPd-
and a molecular weight of 240.62 g/mol. Its IUPAC name is 2-(2-methanidylphenyl)ethanamine;palladium.
Molecular Properties
| Compound Name | 2-(2-methanidylphenyl)ethanamine;palladium |
| PubChem CID | 175142647 |
| Molecular Formula | C9H12NPd- |
| Molecular Weight | 240.62 g/mol |
| Exact Mass | 240.00 |
| IUPAC Name | 2-(2-methanidylphenyl)ethanamine;palladium |
| SMILES | [CH2-]c1ccccc1CCN.[Pd] |
| InChI | InChI=1S/C9H12N.Pd/c1-8-4-2-3-5-9(8)6-7-10;/h2-5H,1,6-7,10H2;/q-1; |
| InChIKey | DIBWJSFLYUHOBU-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.62 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methanidylphenyl)ethanamine;palladium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methanidylphenyl)ethanamine;palladium?
The IUPAC name of 2-(2-methanidylphenyl)ethanamine;palladium (CID 175142647) is 2-(2-methanidylphenyl)ethanamine;palladium.
What is the SMILES notation for 2-(2-methanidylphenyl)ethanamine;palladium?
The canonical SMILES for 2-(2-methanidylphenyl)ethanamine;palladium is [CH2-]c1ccccc1CCN.[Pd].
What is the InChIKey of 2-(2-methanidylphenyl)ethanamine;palladium?
The InChIKey is DIBWJSFLYUHOBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N.Pd/c1-8-4-2-3-5-9(8)6-7-10;/h2-5H,1,6-7,10H2;/q-1;.
What are the key properties of 2-(2-methanidylphenyl)ethanamine;palladium?
2-(2-methanidylphenyl)ethanamine;palladium has a molecular weight of 240.62 g/mol, XLogP of 1.37, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methanidylphenyl)ethanamine;palladium is sourced from PubChem (CID 175142647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).