C20H19F2N3O3 — CID 175144515
N-[2-(2-ethoxyethoxy)-5-(1H-imidazol-2-yl)phenyl]-3,4-difluorobenzamide (PubChem CID 175144515) has the molecular formula C20H19F2N3O3 and a molecular weight of 387.39 g/mol. Its IUPAC name is N-[2-(2-ethoxyethoxy)-5-(1H-imidazol-2-yl)phenyl]-3,4-difluorobenzamide.
| Compound Name | N-[2-(2-ethoxyethoxy)-5-(1H-imidazol-2-yl)phenyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 175144515 |
| Molecular Formula | C20H19F2N3O3 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | N-[2-(2-ethoxyethoxy)-5-(1H-imidazol-2-yl)phenyl]-3,4-difluorobenzamide |
| SMILES | CCOCCOc1ccc(-c2ncc[nH]2)cc1NC(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C20H19F2N3O3/c1-2-27-9-10-28-18-6-4-13(19-23-7-8-24-19)12-17(18)25-20(26)14-3-5-15(21)16(22)11-14/h3-8,11-12H,2,9-10H2,1H3,(H,23,24)(H,25,26) |
| InChIKey | STTKWLUDHZDDLV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|