About N-[2-(2-ethoxyethoxy)-5-(1H-imidazol-2-yl)phenyl]-3,4-difluorobenzamide
N-[2-(2-ethoxyethoxy)-5-(1H-imidazol-2-yl)phenyl]-3,4-difluorobenzamide (PubChem CID 175144515) has the molecular formula C20H19F2N3O3
and a molecular weight of 387.39 g/mol. Its IUPAC name is N-[2-(2-ethoxyethoxy)-5-(1H-imidazol-2-yl)phenyl]-3,4-difluorobenzamide.
Molecular Properties
| Compound Name | N-[2-(2-ethoxyethoxy)-5-(1H-imidazol-2-yl)phenyl]-3,4-difluorobenzamide |
| PubChem CID | 175144515 |
| Molecular Formula | C20H19F2N3O3 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | N-[2-(2-ethoxyethoxy)-5-(1H-imidazol-2-yl)phenyl]-3,4-difluorobenzamide |
| SMILES | CCOCCOc1ccc(-c2ncc[nH]2)cc1NC(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C20H19F2N3O3/c1-2-27-9-10-28-18-6-4-13(19-23-7-8-24-19)12-17(18)25-20(26)14-3-5-15(21)16(22)11-14/h3-8,11-12H,2,9-10H2,1H3,(H,23,24)(H,25,26) |
| InChIKey | STTKWLUDHZDDLV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(2-ethoxyethoxy)-5-(1H-imidazol-2-yl)phenyl]-3,4-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2-ethoxyethoxy)-5-(1H-imidazol-2-yl)phenyl]-3,4-difluorobenzamide?
The IUPAC name of N-[2-(2-ethoxyethoxy)-5-(1H-imidazol-2-yl)phenyl]-3,4-difluorobenzamide (CID 175144515) is N-[2-(2-ethoxyethoxy)-5-(1H-imidazol-2-yl)phenyl]-3,4-difluorobenzamide.
What is the SMILES notation for N-[2-(2-ethoxyethoxy)-5-(1H-imidazol-2-yl)phenyl]-3,4-difluorobenzamide?
The canonical SMILES for N-[2-(2-ethoxyethoxy)-5-(1H-imidazol-2-yl)phenyl]-3,4-difluorobenzamide is CCOCCOc1ccc(-c2ncc[nH]2)cc1NC(=O)c1ccc(F)c(F)c1.
What is the InChIKey of N-[2-(2-ethoxyethoxy)-5-(1H-imidazol-2-yl)phenyl]-3,4-difluorobenzamide?
The InChIKey is STTKWLUDHZDDLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19F2N3O3/c1-2-27-9-10-28-18-6-4-13(19-23-7-8-24-19)12-17(18)25-20(26)14-3-5-15(21)16(22)11-14/h3-8,11-12H,2,9-10H2,1H3,(H,23,24)(H,25,26).
What are the key properties of N-[2-(2-ethoxyethoxy)-5-(1H-imidazol-2-yl)phenyl]-3,4-difluorobenzamide?
N-[2-(2-ethoxyethoxy)-5-(1H-imidazol-2-yl)phenyl]-3,4-difluorobenzamide has a molecular weight of 387.39 g/mol, XLogP of 4.02, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2-ethoxyethoxy)-5-(1H-imidazol-2-yl)phenyl]-3,4-difluorobenzamide is sourced from PubChem (CID 175144515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).