C11H27N3O — CID 175145036
2,2,2-tris(propan-2-ylamino)ethanol (PubChem CID 175145036) has the molecular formula C11H27N3O and a molecular weight of 217.36 g/mol. Its IUPAC name is 2,2,2-tris(propan-2-ylamino)ethanol.
| Compound Name | 2,2,2-tris(propan-2-ylamino)ethanol |
|---|---|
| PubChem CID | 175145036 |
| Molecular Formula | C11H27N3O |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.22 |
| IUPAC Name | 2,2,2-tris(propan-2-ylamino)ethanol |
| SMILES | CC(C)NC(CO)(NC(C)C)NC(C)C |
| InChI | InChI=1S/C11H27N3O/c1-8(2)12-11(7-15,13-9(3)4)14-10(5)6/h8-10,12-15H,7H2,1-6H3 |
| InChIKey | IUUVMBFSKYXKNC-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|