C13H34N4Si — CID 123271781
1-N,1-N',1-N"-tri(propan-2-yl)-4-N-silylbutane-1,1,1,4-tetramine (PubChem CID 123271781) has the molecular formula C13H34N4Si and a molecular weight of 274.53 g/mol. Its IUPAC name is 1-N,1-N',1-N"-tri(propan-2-yl)-4-N-silylbutane-1,1,1,4-tetramine.
| Compound Name | 1-N,1-N',1-N"-tri(propan-2-yl)-4-N-silylbutane-1,1,1,4-tetramine |
|---|---|
| PubChem CID | 123271781 |
| Molecular Formula | C13H34N4Si |
| Molecular Weight | 274.53 g/mol |
| Exact Mass | 274.26 |
| IUPAC Name | 1-N,1-N',1-N"-tri(propan-2-yl)-4-N-silylbutane-1,1,1,4-tetramine |
| SMILES | CC(C)NC(CCCN[SiH3])(NC(C)C)NC(C)C |
| InChI | InChI=1S/C13H34N4Si/c1-10(2)15-13(16-11(3)4,17-12(5)6)8-7-9-14-18/h10-12,14-17H,7-9H2,1-6,18H3 |
| InChIKey | OMOGOEUFLNCATC-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.53 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|