C10H26N2Si — CID 175502778
N',N'-di(butan-2-yl)-N-silylethane-1,2-diamine (PubChem CID 175502778) has the molecular formula C10H26N2Si and a molecular weight of 202.42 g/mol. Its IUPAC name is N',N'-di(butan-2-yl)-N-silylethane-1,2-diamine.
| Compound Name | N',N'-di(butan-2-yl)-N-silylethane-1,2-diamine |
|---|---|
| PubChem CID | 175502778 |
| Molecular Formula | C10H26N2Si |
| Molecular Weight | 202.42 g/mol |
| Exact Mass | 202.19 |
| IUPAC Name | N',N'-di(butan-2-yl)-N-silylethane-1,2-diamine |
| SMILES | CCC(C)N(CCN[SiH3])C(C)CC |
| InChI | InChI=1S/C10H26N2Si/c1-5-9(3)12(8-7-11-13)10(4)6-2/h9-11H,5-8H2,1-4,13H3 |
| InChIKey | DCKLOLSFAZXLOZ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.42 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|