C14H21N3O4 — CID 175145331
2-[2-[(4-amino-2-ethylbenzoyl)amino]ethoxy]ethyl carbamate (PubChem CID 175145331) has the molecular formula C14H21N3O4 and a molecular weight of 295.34 g/mol. Its IUPAC name is 2-[2-[(4-amino-2-ethylbenzoyl)amino]ethoxy]ethyl carbamate.
| Compound Name | 2-[2-[(4-amino-2-ethylbenzoyl)amino]ethoxy]ethyl carbamate |
|---|---|
| PubChem CID | 175145331 |
| Molecular Formula | C14H21N3O4 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 2-[2-[(4-amino-2-ethylbenzoyl)amino]ethoxy]ethyl carbamate |
| SMILES | CCc1cc(N)ccc1C(=O)NCCOCCOC(N)=O |
| InChI | InChI=1S/C14H21N3O4/c1-2-10-9-11(15)3-4-12(10)13(18)17-5-6-20-7-8-21-14(16)19/h3-4,9H,2,5-8,15H2,1H3,(H2,16,19)(H,17,18) |
| InChIKey | WXRKOROXUOBNSK-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|