C7H2Br2N2O2S — CID 175147616
4,7-dibromo-5-nitro-1,2-benzothiazole (PubChem CID 175147616) has the molecular formula C7H2Br2N2O2S and a molecular weight of 337.98 g/mol. Its IUPAC name is 4,7-dibromo-5-nitro-1,2-benzothiazole.
| Compound Name | 4,7-dibromo-5-nitro-1,2-benzothiazole |
|---|---|
| PubChem CID | 175147616 |
| Molecular Formula | C7H2Br2N2O2S |
| Molecular Weight | 337.98 g/mol |
| Exact Mass | 335.82 |
| IUPAC Name | 4,7-dibromo-5-nitro-1,2-benzothiazole |
| SMILES | O=[N+]([O-])c1cc(Br)c2sncc2c1Br |
| InChI | InChI=1S/C7H2Br2N2O2S/c8-4-1-5(11(12)13)6(9)3-2-10-14-7(3)4/h1-2H |
| InChIKey | IBLFKTICVZOZOV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.98 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|