C36H42N10O2 — CID 175147638
methyl 3,4-bis[2-[(1-cyclohexylpyrazol-4-yl)amino]-5-methylpyrimidin-4-yl]benzoate (PubChem CID 175147638) has the molecular formula C36H42N10O2 and a molecular weight of 646.80 g/mol. Its IUPAC name is methyl 3,4-bis[2-[(1-cyclohexylpyrazol-4-yl)amino]-5-methylpyrimidin-4-yl]benzoate.
| Compound Name | methyl 3,4-bis[2-[(1-cyclohexylpyrazol-4-yl)amino]-5-methylpyrimidin-4-yl]benzoate |
|---|---|
| PubChem CID | 175147638 |
| Molecular Formula | C36H42N10O2 |
| Molecular Weight | 646.80 g/mol |
| Exact Mass | 646.35 |
| IUPAC Name | methyl 3,4-bis[2-[(1-cyclohexylpyrazol-4-yl)amino]-5-methylpyrimidin-4-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2nc(Nc3cnn(C4CCCCC4)c3)ncc2C)c(-c2nc(Nc3cnn(C4CCCCC4)c3)ncc2C)c1 |
| InChI | InChI=1S/C36H42N10O2/c1-23-17-37-35(41-26-19-39-45(21-26)28-10-6-4-7-11-28)43-32(23)30-15-14-25(34(47)48-3)16-31(30)33-24(2)18-38-36(44-33)42-27-20-40-46(22-27)29-12-8-5-9-13-29/h14-22,28-29H,4-13H2,1-3H3,(H,37,41,43)(H,38,42,44) |
| InChIKey | ZDEFAAZZTGMZIN-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 137.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.80 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |