C19H26O4 — CID 175148441
3-undec-10-en-5-ylphthalic acid (PubChem CID 175148441) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is 3-undec-10-en-5-ylphthalic acid.
| Compound Name | 3-undec-10-en-5-ylphthalic acid |
|---|---|
| PubChem CID | 175148441 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 3-undec-10-en-5-ylphthalic acid |
| SMILES | C=CCCCCC(CCCC)c1cccc(C(=O)O)c1C(=O)O |
| InChI | InChI=1S/C19H26O4/c1-3-5-7-8-11-14(10-6-4-2)15-12-9-13-16(18(20)21)17(15)19(22)23/h3,9,12-14H,1,4-8,10-11H2,2H3,(H,20,21)(H,22,23) |
| InChIKey | UMUIBPVKKZHGAS-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|