About 3-dec-1-en-3-ylphthalic acid
3-dec-1-en-3-ylphthalic acid (PubChem CID 67068934) has the molecular formula C18H24O4
and a molecular weight of 304.39 g/mol. Its IUPAC name is 3-dec-1-en-3-ylphthalic acid.
Molecular Properties
| Compound Name | 3-dec-1-en-3-ylphthalic acid |
| PubChem CID | 67068934 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 3-dec-1-en-3-ylphthalic acid |
| SMILES | C=CC(CCCCCCC)c1cccc(C(=O)O)c1C(=O)O |
| InChI | InChI=1S/C18H24O4/c1-3-5-6-7-8-10-13(4-2)14-11-9-12-15(17(19)20)16(14)18(21)22/h4,9,11-13H,2-3,5-8,10H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | MSEKHBOPCKSXRW-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-dec-1-en-3-ylphthalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-dec-1-en-3-ylphthalic acid?
The IUPAC name of 3-dec-1-en-3-ylphthalic acid (CID 67068934) is 3-dec-1-en-3-ylphthalic acid.
What is the SMILES notation for 3-dec-1-en-3-ylphthalic acid?
The canonical SMILES for 3-dec-1-en-3-ylphthalic acid is C=CC(CCCCCCC)c1cccc(C(=O)O)c1C(=O)O.
What is the InChIKey of 3-dec-1-en-3-ylphthalic acid?
The InChIKey is MSEKHBOPCKSXRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24O4/c1-3-5-6-7-8-10-13(4-2)14-11-9-12-15(17(19)20)16(14)18(21)22/h4,9,11-13H,2-3,5-8,10H2,1H3,(H,19,20)(H,21,22).
What are the key properties of 3-dec-1-en-3-ylphthalic acid?
3-dec-1-en-3-ylphthalic acid has a molecular weight of 304.39 g/mol, XLogP of 4.71, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-dec-1-en-3-ylphthalic acid is sourced from PubChem (CID 67068934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).