About 2-oct-1-en-3-ylphenol
2-oct-1-en-3-ylphenol (PubChem CID 174457619) has the molecular formula C14H20O
and a molecular weight of 204.31 g/mol. Its IUPAC name is 2-oct-1-en-3-ylphenol.
Molecular Properties
| Compound Name | 2-oct-1-en-3-ylphenol |
| PubChem CID | 174457619 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | 2-oct-1-en-3-ylphenol |
| SMILES | C=CC(CCCCC)c1ccccc1O |
| InChI | InChI=1S/C14H20O/c1-3-5-6-9-12(4-2)13-10-7-8-11-14(13)15/h4,7-8,10-12,15H,2-3,5-6,9H2,1H3 |
| InChIKey | HMICNNGSXOMFFI-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-oct-1-en-3-ylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oct-1-en-3-ylphenol?
The IUPAC name of 2-oct-1-en-3-ylphenol (CID 174457619) is 2-oct-1-en-3-ylphenol.
What is the SMILES notation for 2-oct-1-en-3-ylphenol?
The canonical SMILES for 2-oct-1-en-3-ylphenol is C=CC(CCCCC)c1ccccc1O.
What is the InChIKey of 2-oct-1-en-3-ylphenol?
The InChIKey is HMICNNGSXOMFFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O/c1-3-5-6-9-12(4-2)13-10-7-8-11-14(13)15/h4,7-8,10-12,15H,2-3,5-6,9H2,1H3.
What are the key properties of 2-oct-1-en-3-ylphenol?
2-oct-1-en-3-ylphenol has a molecular weight of 204.31 g/mol, XLogP of 4.24, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oct-1-en-3-ylphenol is sourced from PubChem (CID 174457619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).