C21H41NaO4 — CID 175149333
sodium;(Z)-octadec-9-enoate;propane-1,2-diol (PubChem CID 175149333) has the molecular formula C21H41NaO4 and a molecular weight of 380.55 g/mol. Its IUPAC name is sodium;(Z)-octadec-9-enoate;propane-1,2-diol.
| Compound Name | sodium;(Z)-octadec-9-enoate;propane-1,2-diol |
|---|---|
| PubChem CID | 175149333 |
| Molecular Formula | C21H41NaO4 |
| Molecular Weight | 380.55 g/mol |
| Exact Mass | 380.29 |
| IUPAC Name | sodium;(Z)-octadec-9-enoate;propane-1,2-diol |
| SMILES | CC(O)CO.CCCCCCCC/C=C\CCCCCCCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C18H34O2.C3H8O2.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-3(5)2-4;/h9-10H,2-8,11-17H2,1H3,(H,19,20);3-5H,2H2,1H3;/q;;+1/p-1/b10-9-;; |
| InChIKey | FTSXQKNQSALFPP-XXAVUKJNSA-M |
| XLogP | 1.14 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.55 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|