About dihydroxy(oxo)phosphanium;3-methylchromen-2-one
dihydroxy(oxo)phosphanium;3-methylchromen-2-one (PubChem CID 175149371) has the molecular formula C10H10O5P+
and a molecular weight of 241.16 g/mol. Its IUPAC name is dihydroxy(oxo)phosphanium;3-methylchromen-2-one.
Molecular Properties
| Compound Name | dihydroxy(oxo)phosphanium;3-methylchromen-2-one |
| PubChem CID | 175149371 |
| Molecular Formula | C10H10O5P+ |
| Molecular Weight | 241.16 g/mol |
| Exact Mass | 241.03 |
| IUPAC Name | dihydroxy(oxo)phosphanium;3-methylchromen-2-one |
| SMILES | Cc1cc2ccccc2oc1=O.O=[P+](O)O |
| InChI | InChI=1S/C10H8O2.HO3P/c1-7-6-8-4-2-3-5-9(8)12-10(7)11;1-4(2)3/h2-6H,1H3;(H-,1,2,3)/p+1 |
| InChIKey | KNJXIZPMERGYAC-UHFFFAOYSA-O |
| XLogP | 1.73 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.16 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dihydroxy(oxo)phosphanium;3-methylchromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxy(oxo)phosphanium;3-methylchromen-2-one?
The IUPAC name of dihydroxy(oxo)phosphanium;3-methylchromen-2-one (CID 175149371) is dihydroxy(oxo)phosphanium;3-methylchromen-2-one.
What is the SMILES notation for dihydroxy(oxo)phosphanium;3-methylchromen-2-one?
The canonical SMILES for dihydroxy(oxo)phosphanium;3-methylchromen-2-one is Cc1cc2ccccc2oc1=O.O=[P+](O)O.
What is the InChIKey of dihydroxy(oxo)phosphanium;3-methylchromen-2-one?
The InChIKey is KNJXIZPMERGYAC-UHFFFAOYSA-O. The full InChI is InChI=1S/C10H8O2.HO3P/c1-7-6-8-4-2-3-5-9(8)12-10(7)11;1-4(2)3/h2-6H,1H3;(H-,1,2,3)/p+1.
What are the key properties of dihydroxy(oxo)phosphanium;3-methylchromen-2-one?
dihydroxy(oxo)phosphanium;3-methylchromen-2-one has a molecular weight of 241.16 g/mol, XLogP of 1.73, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxy(oxo)phosphanium;3-methylchromen-2-one is sourced from PubChem (CID 175149371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).