C23H22Cl2N4O3 — CID 175152010
1-amino-3-(4-methoxyphenyl)urea;2-(2,4-dichlorophenyl)-2,3-dihydro-1H-quinolin-4-one (PubChem CID 175152010) has the molecular formula C23H22Cl2N4O3 and a molecular weight of 473.36 g/mol. Its IUPAC name is 1-amino-3-(4-methoxyphenyl)urea;2-(2,4-dichlorophenyl)-2,3-dihydro-1H-quinolin-4-one.
| Compound Name | 1-amino-3-(4-methoxyphenyl)urea;2-(2,4-dichlorophenyl)-2,3-dihydro-1H-quinolin-4-one |
|---|---|
| PubChem CID | 175152010 |
| Molecular Formula | C23H22Cl2N4O3 |
| Molecular Weight | 473.36 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | 1-amino-3-(4-methoxyphenyl)urea;2-(2,4-dichlorophenyl)-2,3-dihydro-1H-quinolin-4-one |
| SMILES | COc1ccc(NC(=O)NN)cc1.O=C1CC(c2ccc(Cl)cc2Cl)Nc2ccccc21 |
| InChI | InChI=1S/C15H11Cl2NO.C8H11N3O2/c16-9-5-6-10(12(17)7-9)14-8-15(19)11-3-1-2-4-13(11)18-14;1-13-7-4-2-6(3-5-7)10-8(12)11-9/h1-7,14,18H,8H2;2-5H,9H2,1H3,(H2,10,11,12) |
| InChIKey | ZMZLQMSHJQRIEY-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.36 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|