C20H17Cl2N5O2 — CID 992431
(7S)-7-(2,4-dichlorophenyl)-N-(4-methoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 992431) has the molecular formula C20H17Cl2N5O2 and a molecular weight of 430.30 g/mol. Its IUPAC name is (7S)-7-(2,4-dichlorophenyl)-N-(4-methoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | (7S)-7-(2,4-dichlorophenyl)-N-(4-methoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 992431 |
| Molecular Formula | C20H17Cl2N5O2 |
| Molecular Weight | 430.30 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | (7S)-7-(2,4-dichlorophenyl)-N-(4-methoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1ccc(NC(=O)C2=C(C)Nc3ncnn3[C@@H]2c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C20H17Cl2N5O2/c1-11-17(19(28)26-13-4-6-14(29-2)7-5-13)18(27-20(25-11)23-10-24-27)15-8-3-12(21)9-16(15)22/h3-10,18H,1-2H3,(H,26,28)(H,23,24,25)/t18-/m1/s1 |
| InChIKey | SKKHUMVTNSRBRJ-GOSISDBHSA-N |
| XLogP | 4.52 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.30 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |