C33H33NO7 — CID 175153672
(2S)-2-[tert-butyl(9H-fluoren-9-ylmethoxycarbonyl)amino]-4-oxo-4-[(E)-4-oxo-4-phenylbut-2-en-2-yl]oxybutanoic acid (PubChem CID 175153672) has the molecular formula C33H33NO7 and a molecular weight of 555.63 g/mol. Its IUPAC name is (2S)-2-[tert-butyl(9H-fluoren-9-ylmethoxycarbonyl)amino]-4-oxo-4-[(E)-4-oxo-4-phenylbut-2-en-2-yl]oxybutanoic acid.
| Compound Name | (2S)-2-[tert-butyl(9H-fluoren-9-ylmethoxycarbonyl)amino]-4-oxo-4-[(E)-4-oxo-4-phenylbut-2-en-2-yl]oxybutanoic acid |
|---|---|
| PubChem CID | 175153672 |
| Molecular Formula | C33H33NO7 |
| Molecular Weight | 555.63 g/mol |
| Exact Mass | 555.23 |
| IUPAC Name | (2S)-2-[tert-butyl(9H-fluoren-9-ylmethoxycarbonyl)amino]-4-oxo-4-[(E)-4-oxo-4-phenylbut-2-en-2-yl]oxybutanoic acid |
| SMILES | C/C(=C\C(=O)c1ccccc1)OC(=O)C[C@@H](C(=O)O)N(C(=O)OCC1c2ccccc2-c2ccccc21)C(C)(C)C |
| InChI | InChI=1S/C33H33NO7/c1-21(18-29(35)22-12-6-5-7-13-22)41-30(36)19-28(31(37)38)34(33(2,3)4)32(39)40-20-27-25-16-10-8-14-23(25)24-15-9-11-17-26(24)27/h5-18,27-28H,19-20H2,1-4H3,(H,37,38)/b21-18+/t28-/m0/s1 |
| InChIKey | BVARIRQGHHTAJL-XGLNBYONSA-N |
| XLogP | 6.21 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.63 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|