C31H34ClN3O5 — CID 175153691
(2S)-1-[[3-chloro-4-[[1-[5-(hydroxymethyl)-1,2,4-oxadiazol-3-yl]-6,6-dimethyl-5-phenylcyclohexa-2,4-dien-1-yl]methoxy]phenyl]methyl]piperidine-2-carboxylic acid (PubChem CID 175153691) has the molecular formula C31H34ClN3O5 and a molecular weight of 564.08 g/mol. Its IUPAC name is (2S)-1-[[3-chloro-4-[[1-[5-(hydroxymethyl)-1,2,4-oxadiazol-3-yl]-6,6-dimethyl-5-phenylcyclohexa-2,4-dien-1-yl]methoxy]phenyl]methyl]piperidine-2-carboxylic acid.
| Compound Name | (2S)-1-[[3-chloro-4-[[1-[5-(hydroxymethyl)-1,2,4-oxadiazol-3-yl]-6,6-dimethyl-5-phenylcyclohexa-2,4-dien-1-yl]methoxy]phenyl]methyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 175153691 |
| Molecular Formula | C31H34ClN3O5 |
| Molecular Weight | 564.08 g/mol |
| Exact Mass | 563.22 |
| IUPAC Name | (2S)-1-[[3-chloro-4-[[1-[5-(hydroxymethyl)-1,2,4-oxadiazol-3-yl]-6,6-dimethyl-5-phenylcyclohexa-2,4-dien-1-yl]methoxy]phenyl]methyl]piperidine-2-carboxylic acid |
| SMILES | CC1(C)C(c2ccccc2)=CC=CC1(COc1ccc(CN2CCCC[C@H]2C(=O)O)cc1Cl)c1noc(CO)n1 |
| InChI | InChI=1S/C31H34ClN3O5/c1-30(2)23(22-9-4-3-5-10-22)11-8-15-31(30,29-33-27(19-36)40-34-29)20-39-26-14-13-21(17-24(26)32)18-35-16-7-6-12-25(35)28(37)38/h3-5,8-11,13-15,17,25,36H,6-7,12,16,18-20H2,1-2H3,(H,37,38)/t25-,31?/m0/s1 |
| InChIKey | GOBZCKJCTDBKRW-ZGAORZAOSA-N |
| XLogP | 5.65 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.08 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |