C14H18O5 — CID 175155335
prop-2-enyl 2-(2,3,6-trimethoxyphenyl)acetate (PubChem CID 175155335) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is prop-2-enyl 2-(2,3,6-trimethoxyphenyl)acetate.
| Compound Name | prop-2-enyl 2-(2,3,6-trimethoxyphenyl)acetate |
|---|---|
| PubChem CID | 175155335 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | prop-2-enyl 2-(2,3,6-trimethoxyphenyl)acetate |
| SMILES | C=CCOC(=O)Cc1c(OC)ccc(OC)c1OC |
| InChI | InChI=1S/C14H18O5/c1-5-8-19-13(15)9-10-11(16-2)6-7-12(17-3)14(10)18-4/h5-7H,1,8-9H2,2-4H3 |
| InChIKey | WJXQKQSRBBKMLP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|