C14H17F5N2O — CID 175156494
3-(difluoromethoxymethyl)-1-[[4-(trifluoromethyl)phenyl]methyl]piperazine (PubChem CID 175156494) has the molecular formula C14H17F5N2O and a molecular weight of 324.29 g/mol. Its IUPAC name is 3-(difluoromethoxymethyl)-1-[[4-(trifluoromethyl)phenyl]methyl]piperazine.
| Compound Name | 3-(difluoromethoxymethyl)-1-[[4-(trifluoromethyl)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 175156494 |
| Molecular Formula | C14H17F5N2O |
| Molecular Weight | 324.29 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 3-(difluoromethoxymethyl)-1-[[4-(trifluoromethyl)phenyl]methyl]piperazine |
| SMILES | FC(F)OCC1CN(Cc2ccc(C(F)(F)F)cc2)CCN1 |
| InChI | InChI=1S/C14H17F5N2O/c15-13(16)22-9-12-8-21(6-5-20-12)7-10-1-3-11(4-2-10)14(17,18)19/h1-4,12-13,20H,5-9H2 |
| InChIKey | JABNDTZIMITEFB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.29 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |