C21H17NO5 — CID 175157119
2-ethoxyethyl 2-(2-cyano-9,10-dioxoanthracen-1-yl)acetate (PubChem CID 175157119) has the molecular formula C21H17NO5 and a molecular weight of 363.37 g/mol. Its IUPAC name is 2-ethoxyethyl 2-(2-cyano-9,10-dioxoanthracen-1-yl)acetate.
| Compound Name | 2-ethoxyethyl 2-(2-cyano-9,10-dioxoanthracen-1-yl)acetate |
|---|---|
| PubChem CID | 175157119 |
| Molecular Formula | C21H17NO5 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 2-ethoxyethyl 2-(2-cyano-9,10-dioxoanthracen-1-yl)acetate |
| SMILES | CCOCCOC(=O)Cc1c(C#N)ccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C21H17NO5/c1-2-26-9-10-27-18(23)11-17-13(12-22)7-8-16-19(17)21(25)15-6-4-3-5-14(15)20(16)24/h3-8H,2,9-11H2,1H3 |
| InChIKey | KNAREQGBQMKLNM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 93.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|