C28H25N3O6S2 — CID 175157655
(2R)-N-(furan-2-ylmethyl)-2-methoxy-2-[(2-oxo-1H-quinolin-6-yl)sulfonylamino]-2-phenyl-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 175157655) has the molecular formula C28H25N3O6S2 and a molecular weight of 563.66 g/mol. Its IUPAC name is (2R)-N-(furan-2-ylmethyl)-2-methoxy-2-[(2-oxo-1H-quinolin-6-yl)sulfonylamino]-2-phenyl-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | (2R)-N-(furan-2-ylmethyl)-2-methoxy-2-[(2-oxo-1H-quinolin-6-yl)sulfonylamino]-2-phenyl-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 175157655 |
| Molecular Formula | C28H25N3O6S2 |
| Molecular Weight | 563.66 g/mol |
| Exact Mass | 563.12 |
| IUPAC Name | (2R)-N-(furan-2-ylmethyl)-2-methoxy-2-[(2-oxo-1H-quinolin-6-yl)sulfonylamino]-2-phenyl-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | CO[C@@](NS(=O)(=O)c1ccc2[nH]c(=O)ccc2c1)(C(=O)N(Cc1ccco1)Cc1cccs1)c1ccccc1 |
| InChI | InChI=1S/C28H25N3O6S2/c1-36-28(21-7-3-2-4-8-21,27(33)31(18-22-9-5-15-37-22)19-23-10-6-16-38-23)30-39(34,35)24-12-13-25-20(17-24)11-14-26(32)29-25/h2-17,30H,18-19H2,1H3,(H,29,32)/t28-/m1/s1 |
| InChIKey | HGQIBMFNRFCCEQ-MUUNZHRXSA-N |
| XLogP | 4.19 |
| TPSA | 121.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.66 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|