C18H15F2NO4S2 — CID 9094982
4-(difluoromethylsulfonyl)-N-(furan-2-ylmethyl)-N-(thiophen-2-ylmethyl)benzamide (PubChem CID 9094982) has the molecular formula C18H15F2NO4S2 and a molecular weight of 411.45 g/mol. Its IUPAC name is 4-(difluoromethylsulfonyl)-N-(furan-2-ylmethyl)-N-(thiophen-2-ylmethyl)benzamide.
| Compound Name | 4-(difluoromethylsulfonyl)-N-(furan-2-ylmethyl)-N-(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 9094982 |
| Molecular Formula | C18H15F2NO4S2 |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.04 |
| IUPAC Name | 4-(difluoromethylsulfonyl)-N-(furan-2-ylmethyl)-N-(thiophen-2-ylmethyl)benzamide |
| SMILES | O=C(c1ccc(S(=O)(=O)C(F)F)cc1)N(Cc1ccco1)Cc1cccs1 |
| InChI | InChI=1S/C18H15F2NO4S2/c19-18(20)27(23,24)16-7-5-13(6-8-16)17(22)21(11-14-3-1-9-25-14)12-15-4-2-10-26-15/h1-10,18H,11-12H2 |
| InChIKey | BQXBGSPQFMKTFR-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |