C23H19FN2O4S2 — CID 31833131
3-[(2-fluorophenyl)sulfamoyl]-N-(furan-2-ylmethyl)-N-(thiophen-2-ylmethyl)benzamide (PubChem CID 31833131) has the molecular formula C23H19FN2O4S2 and a molecular weight of 470.55 g/mol. Its IUPAC name is 3-[(2-fluorophenyl)sulfamoyl]-N-(furan-2-ylmethyl)-N-(thiophen-2-ylmethyl)benzamide.
| Compound Name | 3-[(2-fluorophenyl)sulfamoyl]-N-(furan-2-ylmethyl)-N-(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 31833131 |
| Molecular Formula | C23H19FN2O4S2 |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | 3-[(2-fluorophenyl)sulfamoyl]-N-(furan-2-ylmethyl)-N-(thiophen-2-ylmethyl)benzamide |
| SMILES | O=C(c1cccc(S(=O)(=O)Nc2ccccc2F)c1)N(Cc1ccco1)Cc1cccs1 |
| InChI | InChI=1S/C23H19FN2O4S2/c24-21-10-1-2-11-22(21)25-32(28,29)20-9-3-6-17(14-20)23(27)26(15-18-7-4-12-30-18)16-19-8-5-13-31-19/h1-14,25H,15-16H2 |
| InChIKey | FMSGTTVZHHKPGD-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |