C22H24N2O3S3 — CID 31842594
3-(cyclopentylsulfamoyl)-N,N-bis(thiophen-2-ylmethyl)benzamide (PubChem CID 31842594) has the molecular formula C22H24N2O3S3 and a molecular weight of 460.65 g/mol. Its IUPAC name is 3-(cyclopentylsulfamoyl)-N,N-bis(thiophen-2-ylmethyl)benzamide.
| Compound Name | 3-(cyclopentylsulfamoyl)-N,N-bis(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 31842594 |
| Molecular Formula | C22H24N2O3S3 |
| Molecular Weight | 460.65 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | 3-(cyclopentylsulfamoyl)-N,N-bis(thiophen-2-ylmethyl)benzamide |
| SMILES | O=C(c1cccc(S(=O)(=O)NC2CCCC2)c1)N(Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C22H24N2O3S3/c25-22(24(15-19-9-4-12-28-19)16-20-10-5-13-29-20)17-6-3-11-21(14-17)30(26,27)23-18-7-1-2-8-18/h3-6,9-14,18,23H,1-2,7-8,15-16H2 |
| InChIKey | ATGKONXCDRDZOY-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.65 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |