C21H22N2O3S3 — CID 31840744
5-(cyclopropylsulfamoyl)-2-methyl-N,N-bis(thiophen-2-ylmethyl)benzamide (PubChem CID 31840744) has the molecular formula C21H22N2O3S3 and a molecular weight of 446.62 g/mol. Its IUPAC name is 5-(cyclopropylsulfamoyl)-2-methyl-N,N-bis(thiophen-2-ylmethyl)benzamide.
| Compound Name | 5-(cyclopropylsulfamoyl)-2-methyl-N,N-bis(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 31840744 |
| Molecular Formula | C21H22N2O3S3 |
| Molecular Weight | 446.62 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | 5-(cyclopropylsulfamoyl)-2-methyl-N,N-bis(thiophen-2-ylmethyl)benzamide |
| SMILES | Cc1ccc(S(=O)(=O)NC2CC2)cc1C(=O)N(Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C21H22N2O3S3/c1-15-6-9-19(29(25,26)22-16-7-8-16)12-20(15)21(24)23(13-17-4-2-10-27-17)14-18-5-3-11-28-18/h2-6,9-12,16,22H,7-8,13-14H2,1H3 |
| InChIKey | YOXXPUWTKBMATC-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.62 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |