C44H83Cl5O — CID 175157893
2,6,10,16,20-pentakis(1-chloropentyl)-oxacycloicosane (PubChem CID 175157893) has the molecular formula C44H83Cl5O and a molecular weight of 805.41 g/mol. Its IUPAC name is 2,6,10,16,20-pentakis(1-chloropentyl)-oxacycloicosane.
| Compound Name | 2,6,10,16,20-pentakis(1-chloropentyl)-oxacycloicosane |
|---|---|
| PubChem CID | 175157893 |
| Molecular Formula | C44H83Cl5O |
| Molecular Weight | 805.41 g/mol |
| Exact Mass | 802.49 |
| IUPAC Name | 2,6,10,16,20-pentakis(1-chloropentyl)-oxacycloicosane |
| SMILES | CCCCC(Cl)C1CCCCCC(C(Cl)CCCC)CCCC(C(Cl)CCCC)OC(C(Cl)CCCC)CCCC(C(Cl)CCCC)CCC1 |
| InChI | InChI=1S/C44H83Cl5O/c1-6-11-28-38(45)35-22-17-16-18-23-36(39(46)29-12-7-2)26-20-33-43(41(48)31-14-9-4)50-44(42(49)32-15-10-5)34-21-27-37(25-19-24-35)40(47)30-13-8-3/h35-44H,6-34H2,1-5H3 |
| InChIKey | WWXWBOHTLJBXOG-UHFFFAOYSA-N |
| XLogP | 17.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.41 |
| LogP ≤ 5 | 17.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|