C14H25NO3 — CID 175158520
[1-(4-acetylcyclohexyl)-2,2-dimethylpropyl]carbamic acid (PubChem CID 175158520) has the molecular formula C14H25NO3 and a molecular weight of 255.36 g/mol. Its IUPAC name is [1-(4-acetylcyclohexyl)-2,2-dimethylpropyl]carbamic acid.
| Compound Name | [1-(4-acetylcyclohexyl)-2,2-dimethylpropyl]carbamic acid |
|---|---|
| PubChem CID | 175158520 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | [1-(4-acetylcyclohexyl)-2,2-dimethylpropyl]carbamic acid |
| SMILES | CC(=O)C1CCC(C(NC(=O)O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C14H25NO3/c1-9(16)10-5-7-11(8-6-10)12(14(2,3)4)15-13(17)18/h10-12,15H,5-8H2,1-4H3,(H,17,18) |
| InChIKey | RRCPOULDVATHGV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |