About propyl N-(2-chloroacetyl)-N-(2,6-dimethylphenyl)carbamate
propyl N-(2-chloroacetyl)-N-(2,6-dimethylphenyl)carbamate (PubChem CID 175159773) has the molecular formula C14H18ClNO3
and a molecular weight of 283.76 g/mol. Its IUPAC name is propyl N-(2-chloroacetyl)-N-(2,6-dimethylphenyl)carbamate.
Molecular Properties
| Compound Name | propyl N-(2-chloroacetyl)-N-(2,6-dimethylphenyl)carbamate |
| PubChem CID | 175159773 |
| Molecular Formula | C14H18ClNO3 |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | propyl N-(2-chloroacetyl)-N-(2,6-dimethylphenyl)carbamate |
| SMILES | CCCOC(=O)N(C(=O)CCl)c1c(C)cccc1C |
| InChI | InChI=1S/C14H18ClNO3/c1-4-8-19-14(18)16(12(17)9-15)13-10(2)6-5-7-11(13)3/h5-7H,4,8-9H2,1-3H3 |
| InChIKey | SXQDJISEJUNMQZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze propyl N-(2-chloroacetyl)-N-(2,6-dimethylphenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl N-(2-chloroacetyl)-N-(2,6-dimethylphenyl)carbamate?
The IUPAC name of propyl N-(2-chloroacetyl)-N-(2,6-dimethylphenyl)carbamate (CID 175159773) is propyl N-(2-chloroacetyl)-N-(2,6-dimethylphenyl)carbamate.
What is the SMILES notation for propyl N-(2-chloroacetyl)-N-(2,6-dimethylphenyl)carbamate?
The canonical SMILES for propyl N-(2-chloroacetyl)-N-(2,6-dimethylphenyl)carbamate is CCCOC(=O)N(C(=O)CCl)c1c(C)cccc1C.
What is the InChIKey of propyl N-(2-chloroacetyl)-N-(2,6-dimethylphenyl)carbamate?
The InChIKey is SXQDJISEJUNMQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18ClNO3/c1-4-8-19-14(18)16(12(17)9-15)13-10(2)6-5-7-11(13)3/h5-7H,4,8-9H2,1-3H3.
What are the key properties of propyl N-(2-chloroacetyl)-N-(2,6-dimethylphenyl)carbamate?
propyl N-(2-chloroacetyl)-N-(2,6-dimethylphenyl)carbamate has a molecular weight of 283.76 g/mol, XLogP of 3.42, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propyl N-(2-chloroacetyl)-N-(2,6-dimethylphenyl)carbamate is sourced from PubChem (CID 175159773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).