C22H23Cl2N5O6S2 — CID 175160650
[(1R,2R,3S,4R)-4-[[5-[4-[(R)-amino-(3-chlorophenyl)methyl]-5-chlorothiophene-2-carbonyl]pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentyl]methylsulfamic acid (PubChem CID 175160650) has the molecular formula C22H23Cl2N5O6S2 and a molecular weight of 588.50 g/mol. Its IUPAC name is [(1R,2R,3S,4R)-4-[[5-[4-[(R)-amino-(3-chlorophenyl)methyl]-5-chlorothiophene-2-carbonyl]pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentyl]methylsulfamic acid.
| Compound Name | [(1R,2R,3S,4R)-4-[[5-[4-[(R)-amino-(3-chlorophenyl)methyl]-5-chlorothiophene-2-carbonyl]pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentyl]methylsulfamic acid |
|---|---|
| PubChem CID | 175160650 |
| Molecular Formula | C22H23Cl2N5O6S2 |
| Molecular Weight | 588.50 g/mol |
| Exact Mass | 587.05 |
| IUPAC Name | [(1R,2R,3S,4R)-4-[[5-[4-[(R)-amino-(3-chlorophenyl)methyl]-5-chlorothiophene-2-carbonyl]pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentyl]methylsulfamic acid |
| SMILES | N[C@H](c1cccc(Cl)c1)c1cc(C(=O)c2cncnc2N[C@@H]2C[C@H](CNS(=O)(=O)O)[C@@H](O)[C@H]2O)sc1Cl |
| InChI | InChI=1S/C22H23Cl2N5O6S2/c23-12-3-1-2-10(4-12)17(25)13-6-16(36-21(13)24)19(31)14-8-26-9-27-22(14)29-15-5-11(18(30)20(15)32)7-28-37(33,34)35/h1-4,6,8-9,11,15,17-18,20,28,30,32H,5,7,25H2,(H,26,27,29)(H,33,34,35)/t11-,15-,17-,18-,20+/m1/s1 |
| InChIKey | APOCDUXJHGNQFE-MSUGDQAASA-N |
| XLogP | 2.04 |
| TPSA | 187.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.50 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|