C22H23BrClN5O6S2 — CID 118628795
[(1R,2R,3S,4R)-4-[[5-[4-[(R)-amino-(3-bromophenyl)methyl]-5-chlorothiophene-2-carbonyl]pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentyl]methyl sulfamate (PubChem CID 118628795) has the molecular formula C22H23BrClN5O6S2 and a molecular weight of 632.95 g/mol. Its IUPAC name is [(1R,2R,3S,4R)-4-[[5-[4-[(R)-amino-(3-bromophenyl)methyl]-5-chlorothiophene-2-carbonyl]pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentyl]methyl sulfamate.
| Compound Name | [(1R,2R,3S,4R)-4-[[5-[4-[(R)-amino-(3-bromophenyl)methyl]-5-chlorothiophene-2-carbonyl]pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentyl]methyl sulfamate |
|---|---|
| PubChem CID | 118628795 |
| Molecular Formula | C22H23BrClN5O6S2 |
| Molecular Weight | 632.95 g/mol |
| Exact Mass | 631.00 |
| IUPAC Name | [(1R,2R,3S,4R)-4-[[5-[4-[(R)-amino-(3-bromophenyl)methyl]-5-chlorothiophene-2-carbonyl]pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentyl]methyl sulfamate |
| SMILES | N[C@H](c1cccc(Br)c1)c1cc(C(=O)c2cncnc2N[C@@H]2C[C@H](COS(N)(=O)=O)[C@@H](O)[C@H]2O)sc1Cl |
| InChI | InChI=1S/C22H23BrClN5O6S2/c23-12-3-1-2-10(4-12)17(25)13-6-16(36-21(13)24)19(31)14-7-27-9-28-22(14)29-15-5-11(18(30)20(15)32)8-35-37(26,33)34/h1-4,6-7,9,11,15,17-18,20,30,32H,5,8,25H2,(H2,26,33,34)(H,27,28,29)/t11-,15-,17-,18-,20+/m1/s1 |
| InChIKey | IOHZTQRPOXILGL-MSUGDQAASA-N |
| XLogP | 1.98 |
| TPSA | 190.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.95 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |