C30H45BN4O8 — CID 175160939
2-[[4-[[3-methyl-1-[(2S)-2-[[2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]carbamoyl]pyrrolidin-1-yl]-1-oxobutan-2-yl]carbamoyl]benzoyl]amino]acetic acid (PubChem CID 175160939) has the molecular formula C30H45BN4O8 and a molecular weight of 600.52 g/mol. Its IUPAC name is 2-[[4-[[3-methyl-1-[(2S)-2-[[2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]carbamoyl]pyrrolidin-1-yl]-1-oxobutan-2-yl]carbamoyl]benzoyl]amino]acetic acid.
| Compound Name | 2-[[4-[[3-methyl-1-[(2S)-2-[[2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]carbamoyl]pyrrolidin-1-yl]-1-oxobutan-2-yl]carbamoyl]benzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 175160939 |
| Molecular Formula | C30H45BN4O8 |
| Molecular Weight | 600.52 g/mol |
| Exact Mass | 600.33 |
| IUPAC Name | 2-[[4-[[3-methyl-1-[(2S)-2-[[2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]carbamoyl]pyrrolidin-1-yl]-1-oxobutan-2-yl]carbamoyl]benzoyl]amino]acetic acid |
| SMILES | CC(C)C(NC(=O)[C@@H]1CCCN1C(=O)C(NC(=O)c1ccc(C(=O)NCC(=O)O)cc1)C(C)C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C30H45BN4O8/c1-17(2)23(33-26(39)20-13-11-19(12-14-20)25(38)32-16-22(36)37)28(41)35-15-9-10-21(35)27(40)34-24(18(3)4)31-42-29(5,6)30(7,8)43-31/h11-14,17-18,21,23-24H,9-10,15-16H2,1-8H3,(H,32,38)(H,33,39)(H,34,40)(H,36,37)/t21-,23?,24?/m0/s1 |
| InChIKey | AOZKBYSICSXMNZ-KHRZNOOSSA-N |
| XLogP | 2.02 |
| TPSA | 163.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.52 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|