C21H39BN2O4 — CID 163895121
(2S)-1-[(2S)-2,3-dimethylbutanoyl]-N-[2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]pyrrolidine-2-carboxamide (PubChem CID 163895121) has the molecular formula C21H39BN2O4 and a molecular weight of 394.37 g/mol. Its IUPAC name is (2S)-1-[(2S)-2,3-dimethylbutanoyl]-N-[2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2S)-2,3-dimethylbutanoyl]-N-[2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 163895121 |
| Molecular Formula | C21H39BN2O4 |
| Molecular Weight | 394.37 g/mol |
| Exact Mass | 394.30 |
| IUPAC Name | (2S)-1-[(2S)-2,3-dimethylbutanoyl]-N-[2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]pyrrolidine-2-carboxamide |
| SMILES | CC(C)C(NC(=O)[C@@H]1CCCN1C(=O)[C@@H](C)C(C)C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C21H39BN2O4/c1-13(2)15(5)19(26)24-12-10-11-16(24)18(25)23-17(14(3)4)22-27-20(6,7)21(8,9)28-22/h13-17H,10-12H2,1-9H3,(H,23,25)/t15-,16-,17?/m0/s1 |
| InChIKey | SUYURGBWZYHQEK-PYNWJHIZSA-N |
| XLogP | 3.04 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|