C20H34BN3O5 — CID 58753177
N-[(2S)-1-oxo-1-[(2S)-2-[(2R)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolidine-1-carbonyl]pyrrolidin-1-yl]propan-2-yl]acetamide (PubChem CID 58753177) has the molecular formula C20H34BN3O5 and a molecular weight of 407.32 g/mol. Its IUPAC name is N-[(2S)-1-oxo-1-[(2S)-2-[(2R)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolidine-1-carbonyl]pyrrolidin-1-yl]propan-2-yl]acetamide.
| Compound Name | N-[(2S)-1-oxo-1-[(2S)-2-[(2R)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolidine-1-carbonyl]pyrrolidin-1-yl]propan-2-yl]acetamide |
|---|---|
| PubChem CID | 58753177 |
| Molecular Formula | C20H34BN3O5 |
| Molecular Weight | 407.32 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | N-[(2S)-1-oxo-1-[(2S)-2-[(2R)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolidine-1-carbonyl]pyrrolidin-1-yl]propan-2-yl]acetamide |
| SMILES | CC(=O)N[C@@H](C)C(=O)N1CCC[C@H]1C(=O)N1CCC[C@H]1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C20H34BN3O5/c1-13(22-14(2)25)17(26)23-11-7-9-15(23)18(27)24-12-8-10-16(24)21-28-19(3,4)20(5,6)29-21/h13,15-16H,7-12H2,1-6H3,(H,22,25)/t13-,15-,16-/m0/s1 |
| InChIKey | SHSSKZKHRUVWCX-BPUTZDHNSA-N |
| XLogP | 1.12 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.32 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|