C17H14N4O3S — CID 175161167
5-(3-cyanophenyl)-N-(3-propoxy-1,2,4-thiadiazol-5-yl)furan-3-carboxamide (PubChem CID 175161167) has the molecular formula C17H14N4O3S and a molecular weight of 354.39 g/mol. Its IUPAC name is 5-(3-cyanophenyl)-N-(3-propoxy-1,2,4-thiadiazol-5-yl)furan-3-carboxamide.
| Compound Name | 5-(3-cyanophenyl)-N-(3-propoxy-1,2,4-thiadiazol-5-yl)furan-3-carboxamide |
|---|---|
| PubChem CID | 175161167 |
| Molecular Formula | C17H14N4O3S |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 5-(3-cyanophenyl)-N-(3-propoxy-1,2,4-thiadiazol-5-yl)furan-3-carboxamide |
| SMILES | CCCOc1nsc(NC(=O)c2coc(-c3cccc(C#N)c3)c2)n1 |
| InChI | InChI=1S/C17H14N4O3S/c1-2-6-23-16-20-17(25-21-16)19-15(22)13-8-14(24-10-13)12-5-3-4-11(7-12)9-18/h3-5,7-8,10H,2,6H2,1H3,(H,19,20,21,22) |
| InChIKey | DKRLVEVWGYORBF-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 101.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |