About [10-[(2-oxo-4-phenyl-1-pyridinyl)methyl]-7-azaspiro[4.5]decan-10-yl] 2-propyloctanoate
[10-[(2-oxo-4-phenyl-1-pyridinyl)methyl]-7-azaspiro[4.5]decan-10-yl] 2-propyloctanoate (PubChem CID 175163513) has the molecular formula C32H46N2O3
and a molecular weight of 506.73 g/mol. Its IUPAC name is [10-[(2-oxo-4-phenyl-1-pyridinyl)methyl]-7-azaspiro[4.5]decan-10-yl] 2-propyloctanoate.
Molecular Properties
| Compound Name | [10-[(2-oxo-4-phenyl-1-pyridinyl)methyl]-7-azaspiro[4.5]decan-10-yl] 2-propyloctanoate |
| PubChem CID | 175163513 |
| Molecular Formula | C32H46N2O3 |
| Molecular Weight | 506.73 g/mol |
| Exact Mass | 506.35 |
| IUPAC Name | [10-[(2-oxo-4-phenyl-1-pyridinyl)methyl]-7-azaspiro[4.5]decan-10-yl] 2-propyloctanoate |
| SMILES | CCCCCCC(CCC)C(=O)OC1(Cn2ccc(-c3ccccc3)cc2=O)CCNCC12CCCC2 |
| InChI | InChI=1S/C32H46N2O3/c1-3-5-6-8-16-27(13-4-2)30(36)37-32(20-21-33-24-31(32)18-11-12-19-31)25-34-22-17-28(23-29(34)35)26-14-9-7-10-15-26/h7,9-10,14-15,17,22-23,27,33H,3-6,8,11-13,16,18-21,24-25H2,1-2H3 |
| InChIKey | KOSDKPZGXKWWJK-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 506.73 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [10-[(2-oxo-4-phenyl-1-pyridinyl)methyl]-7-azaspiro[4.5]decan-10-yl] 2-propyloctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [10-[(2-oxo-4-phenyl-1-pyridinyl)methyl]-7-azaspiro[4.5]decan-10-yl] 2-propyloctanoate?
The IUPAC name of [10-[(2-oxo-4-phenyl-1-pyridinyl)methyl]-7-azaspiro[4.5]decan-10-yl] 2-propyloctanoate (CID 175163513) is [10-[(2-oxo-4-phenyl-1-pyridinyl)methyl]-7-azaspiro[4.5]decan-10-yl] 2-propyloctanoate.
What is the SMILES notation for [10-[(2-oxo-4-phenyl-1-pyridinyl)methyl]-7-azaspiro[4.5]decan-10-yl] 2-propyloctanoate?
The canonical SMILES for [10-[(2-oxo-4-phenyl-1-pyridinyl)methyl]-7-azaspiro[4.5]decan-10-yl] 2-propyloctanoate is CCCCCCC(CCC)C(=O)OC1(Cn2ccc(-c3ccccc3)cc2=O)CCNCC12CCCC2.
What is the InChIKey of [10-[(2-oxo-4-phenyl-1-pyridinyl)methyl]-7-azaspiro[4.5]decan-10-yl] 2-propyloctanoate?
The InChIKey is KOSDKPZGXKWWJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H46N2O3/c1-3-5-6-8-16-27(13-4-2)30(36)37-32(20-21-33-24-31(32)18-11-12-19-31)25-34-22-17-28(23-29(34)35)26-14-9-7-10-15-26/h7,9-10,14-15,17,22-23,27,33H,3-6,8,11-13,16,18-21,24-25H2,1-2H3.
What are the key properties of [10-[(2-oxo-4-phenyl-1-pyridinyl)methyl]-7-azaspiro[4.5]decan-10-yl] 2-propyloctanoate?
[10-[(2-oxo-4-phenyl-1-pyridinyl)methyl]-7-azaspiro[4.5]decan-10-yl] 2-propyloctanoate has a molecular weight of 506.73 g/mol, XLogP of 6.74, 12 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [10-[(2-oxo-4-phenyl-1-pyridinyl)methyl]-7-azaspiro[4.5]decan-10-yl] 2-propyloctanoate is sourced from PubChem (CID 175163513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).