C32H46N2O3 — CID 175163513
[10-[(2-oxo-4-phenyl-1-pyridinyl)methyl]-7-azaspiro[4.5]decan-10-yl] 2-propyloctanoate (PubChem CID 175163513) has the molecular formula C32H46N2O3 and a molecular weight of 506.73 g/mol. Its IUPAC name is [10-[(2-oxo-4-phenyl-1-pyridinyl)methyl]-7-azaspiro[4.5]decan-10-yl] 2-propyloctanoate.
| Compound Name | [10-[(2-oxo-4-phenyl-1-pyridinyl)methyl]-7-azaspiro[4.5]decan-10-yl] 2-propyloctanoate |
|---|---|
| PubChem CID | 175163513 |
| Molecular Formula | C32H46N2O3 |
| Molecular Weight | 506.73 g/mol |
| Exact Mass | 506.35 |
| IUPAC Name | [10-[(2-oxo-4-phenyl-1-pyridinyl)methyl]-7-azaspiro[4.5]decan-10-yl] 2-propyloctanoate |
| SMILES | CCCCCCC(CCC)C(=O)OC1(Cn2ccc(-c3ccccc3)cc2=O)CCNCC12CCCC2 |
| InChI | InChI=1S/C32H46N2O3/c1-3-5-6-8-16-27(13-4-2)30(36)37-32(20-21-33-24-31(32)18-11-12-19-31)25-34-22-17-28(23-29(34)35)26-14-9-7-10-15-26/h7,9-10,14-15,17,22-23,27,33H,3-6,8,11-13,16,18-21,24-25H2,1-2H3 |
| InChIKey | KOSDKPZGXKWWJK-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.73 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|