C22H22F2N4O5 — CID 175167830
2-[[2-[2,6-difluoro-4-(methoxycarbamoyl)phenyl]-7-methylimidazo[1,2-a]pyridin-3-yl]methyl]morpholine-4-carboxylic acid (PubChem CID 175167830) has the molecular formula C22H22F2N4O5 and a molecular weight of 460.44 g/mol. Its IUPAC name is 2-[[2-[2,6-difluoro-4-(methoxycarbamoyl)phenyl]-7-methylimidazo[1,2-a]pyridin-3-yl]methyl]morpholine-4-carboxylic acid.
| Compound Name | 2-[[2-[2,6-difluoro-4-(methoxycarbamoyl)phenyl]-7-methylimidazo[1,2-a]pyridin-3-yl]methyl]morpholine-4-carboxylic acid |
|---|---|
| PubChem CID | 175167830 |
| Molecular Formula | C22H22F2N4O5 |
| Molecular Weight | 460.44 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 2-[[2-[2,6-difluoro-4-(methoxycarbamoyl)phenyl]-7-methylimidazo[1,2-a]pyridin-3-yl]methyl]morpholine-4-carboxylic acid |
| SMILES | CONC(=O)c1cc(F)c(-c2nc3cc(C)ccn3c2CC2CN(C(=O)O)CCO2)c(F)c1 |
| InChI | InChI=1S/C22H22F2N4O5/c1-12-3-4-28-17(10-14-11-27(22(30)31)5-6-33-14)20(25-18(28)7-12)19-15(23)8-13(9-16(19)24)21(29)26-32-2/h3-4,7-9,14H,5-6,10-11H2,1-2H3,(H,26,29)(H,30,31) |
| InChIKey | BCKFIRLWOQRRNG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.44 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|