C23H24F2N6O4 — CID 175203989
(2S)-2-[[2-[4-[(1-aminoethylideneamino)carbamoyl]-2,6-difluorophenyl]-7-methylimidazo[1,2-a]pyridin-3-yl]methyl]morpholine-4-carboxylic acid (PubChem CID 175203989) has the molecular formula C23H24F2N6O4 and a molecular weight of 486.48 g/mol. Its IUPAC name is (2S)-2-[[2-[4-[(1-aminoethylideneamino)carbamoyl]-2,6-difluorophenyl]-7-methylimidazo[1,2-a]pyridin-3-yl]methyl]morpholine-4-carboxylic acid.
| Compound Name | (2S)-2-[[2-[4-[(1-aminoethylideneamino)carbamoyl]-2,6-difluorophenyl]-7-methylimidazo[1,2-a]pyridin-3-yl]methyl]morpholine-4-carboxylic acid |
|---|---|
| PubChem CID | 175203989 |
| Molecular Formula | C23H24F2N6O4 |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | (2S)-2-[[2-[4-[(1-aminoethylideneamino)carbamoyl]-2,6-difluorophenyl]-7-methylimidazo[1,2-a]pyridin-3-yl]methyl]morpholine-4-carboxylic acid |
| SMILES | CC(N)=NNC(=O)c1cc(F)c(-c2nc3cc(C)ccn3c2C[C@H]2CN(C(=O)O)CCO2)c(F)c1 |
| InChI | InChI=1S/C23H24F2N6O4/c1-12-3-4-31-18(10-15-11-30(23(33)34)5-6-35-15)21(27-19(31)7-12)20-16(24)8-14(9-17(20)25)22(32)29-28-13(2)26/h3-4,7-9,15H,5-6,10-11H2,1-2H3,(H2,26,28)(H,29,32)(H,33,34)/t15-/m0/s1 |
| InChIKey | NEYLERDWOBFKIX-HNNXBMFYSA-N |
| XLogP | 2.53 |
| TPSA | 134.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|