About N-(5-ethoxy-2,3-dihydro-1H-inden-2-yl)pyrimidin-2-amine
N-(5-ethoxy-2,3-dihydro-1H-inden-2-yl)pyrimidin-2-amine (PubChem CID 175168213) has the molecular formula C15H17N3O
and a molecular weight of 255.32 g/mol. Its IUPAC name is N-(5-ethoxy-2,3-dihydro-1H-inden-2-yl)pyrimidin-2-amine.
Molecular Properties
| Compound Name | N-(5-ethoxy-2,3-dihydro-1H-inden-2-yl)pyrimidin-2-amine |
| PubChem CID | 175168213 |
| Molecular Formula | C15H17N3O |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | N-(5-ethoxy-2,3-dihydro-1H-inden-2-yl)pyrimidin-2-amine |
| SMILES | CCOc1ccc2c(c1)CC(Nc1ncccn1)C2 |
| InChI | InChI=1S/C15H17N3O/c1-2-19-14-5-4-11-8-13(9-12(11)10-14)18-15-16-6-3-7-17-15/h3-7,10,13H,2,8-9H2,1H3,(H,16,17,18) |
| InChIKey | FURXVEVYQDCYBB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(5-ethoxy-2,3-dihydro-1H-inden-2-yl)pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-ethoxy-2,3-dihydro-1H-inden-2-yl)pyrimidin-2-amine?
The IUPAC name of N-(5-ethoxy-2,3-dihydro-1H-inden-2-yl)pyrimidin-2-amine (CID 175168213) is N-(5-ethoxy-2,3-dihydro-1H-inden-2-yl)pyrimidin-2-amine.
What is the SMILES notation for N-(5-ethoxy-2,3-dihydro-1H-inden-2-yl)pyrimidin-2-amine?
The canonical SMILES for N-(5-ethoxy-2,3-dihydro-1H-inden-2-yl)pyrimidin-2-amine is CCOc1ccc2c(c1)CC(Nc1ncccn1)C2.
What is the InChIKey of N-(5-ethoxy-2,3-dihydro-1H-inden-2-yl)pyrimidin-2-amine?
The InChIKey is FURXVEVYQDCYBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3O/c1-2-19-14-5-4-11-8-13(9-12(11)10-14)18-15-16-6-3-7-17-15/h3-7,10,13H,2,8-9H2,1H3,(H,16,17,18).
What are the key properties of N-(5-ethoxy-2,3-dihydro-1H-inden-2-yl)pyrimidin-2-amine?
N-(5-ethoxy-2,3-dihydro-1H-inden-2-yl)pyrimidin-2-amine has a molecular weight of 255.32 g/mol, XLogP of 2.45, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-ethoxy-2,3-dihydro-1H-inden-2-yl)pyrimidin-2-amine is sourced from PubChem (CID 175168213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).